CymitQuimica logo

CAS 76508-35-5

:

propan-2-yl 4-hydroxy-2H-1,2-benzothiazine-3-carboxylate 1,1-dioxide

Description:
Propan-2-yl 4-hydroxy-2H-1,2-benzothiazine-3-carboxylate 1,1-dioxide, with the CAS number 76508-35-5, is a chemical compound characterized by its unique structural features, which include a benzothiazine core. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the propan-2-yl group suggests it may have moderate lipophilicity, influencing its solubility and permeability in biological systems. The hydroxyl group can participate in hydrogen bonding, enhancing its reactivity and interaction with other molecules. Additionally, the carboxylate moiety may confer acidic properties, which can affect its behavior in various chemical environments. This compound may be of interest in medicinal chemistry due to its structural motifs, which are often associated with pharmacological activity. However, specific applications and biological effects would depend on further empirical studies and context within the field of research.
Formula:C12H13NO5S
InChI:InChI=1/C12H13NO5S/c1-7(2)18-12(15)10-11(14)8-5-3-4-6-9(8)19(16,17)13-10/h3-7,13-14H,1-2H3
InChI key:KCSORUCCHDBUFQ-UHFFFAOYSA-N
SMILES:CC(C)OC(=O)C1=C(c2ccccc2S(=O)(=O)N1)O
Found 7 products.