CAS 7651-80-1
:1-Fluoroanthracene
Description:
1-Fluoroanthracene is an aromatic compound characterized by the presence of a fluorine atom attached to the anthracene structure, which consists of three fused benzene rings. This compound typically appears as a solid at room temperature and is known for its stability and relatively low reactivity compared to other halogenated aromatic compounds. Its molecular formula is C14H9F, and it has a distinct fluorescence, making it of interest in various applications, including organic electronics and photonics. The presence of the fluorine atom can influence its electronic properties, potentially enhancing its performance in certain applications. 1-Fluoroanthracene is also used in research related to organic synthesis and materials science. As with many organic compounds, it should be handled with care, following appropriate safety protocols due to potential health hazards associated with exposure.
Formula:C14H9F
InChI:InChI=1S/C14H9F/c15-14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H
InChI key:InChIKey=JBYLHICABMOUQN-UHFFFAOYSA-N
SMILES:FC=1C2=C(C=C3C(=C2)C=CC=C3)C=CC1
Synonyms:- Anthracene, 1-fluoro-
- 1-Fluoroanthracene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.