CAS 7651-81-2
:3(2H)-Isoquinolinone
Description:
3(2H)-Isoquinolinone, with the CAS number 7651-81-2, is a heterocyclic organic compound characterized by its isoquinoline structure, which features a fused benzene and pyridine ring. This compound typically appears as a crystalline solid and is known for its pale yellow to off-white color. It possesses a nitrogen atom in the ring, contributing to its basicity and potential reactivity. The presence of the carbonyl group (C=O) in the 3-position of the isoquinoline framework imparts unique chemical properties, making it a valuable intermediate in organic synthesis and medicinal chemistry. 3(2H)-Isoquinolinone exhibits various biological activities, including potential anti-inflammatory and antitumor effects, which have garnered interest in pharmaceutical research. Its solubility can vary depending on the solvent, and it is generally more soluble in polar organic solvents. Additionally, this compound can undergo various chemical transformations, such as reduction and substitution reactions, making it a versatile building block in the synthesis of more complex molecules.
Formula:C9H7NO
InChI:InChI=1S/C9H7NO/c11-9-5-7-3-1-2-4-8(7)6-10-9/h1-6H,(H,10,11)
InChI key:InChIKey=GYPOFOQUZZUVQL-UHFFFAOYSA-N
SMILES:O=C1C=C2C(=CN1)C=CC=C2
Synonyms:- 2,3-Dihydroisoquinolin-3-One
- 3(2H)-Isoquinolinone
- 3(2H)-Isoquinolone
- 3-Isoquinolinol
- Isoquinolin-3-Ol
- isoquinolin-3(2H)-one
- 3-Hydroxyisoquinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Hydroxyisoquinoline, 99%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H7NOPurity:99%Color and Shape:Yellow, Crystals or powder or crystalline powderMolecular weight:145.16Ref: IN-DA0033Q4
1g43.00€5g111.00€10g168.00€25g268.00€50g647.00€250gTo inquire500gTo inquire250mg25.00€3-Hydroxyisoquinoline
CAS:3-HydroxyisoquinolineFormula:C9H7NOPurity:95%Color and Shape: yellow powderMolecular weight:145.16g/mol3-Hydroxyisoquinoline
CAS:<p>3-Hydroxyisoquinoline is a non-nucleoside inhibitor of cyclic nucleotide phosphodiesterase (cNMP) that is used in the treatment of nervous system diseases. 3-Hydroxyisoquinoline has been shown to have an inhibitory effect on cyclic nucleotide phosphodiesterase and can be used for the treatment of neurological disorders such as Parkinson’s disease, Alzheimer’s disease, and epilepsy. It also has anti-inflammatory properties and can be used to treat pain. 3-Hydroxyisoquinoline has a photoelectron spectrum that peaks at 5.6 eV, with a strong absorption band at 2.1 eV due to hydrogen bonding. This compound is also able to absorb radiation in the form of light emission with an emission peak at 4.8 eV, with a maximum intensity around 830 nm and a half-life of 0.2 s. 3-Hydroxyisoquinoline is able to</p>Formula:C9H7NOPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:145.16 g/mol




