CAS 7652-46-2
:methyl N-acetyl-L-cysteinate
Description:
Methyl N-acetyl-L-cysteinate, with the CAS number 7652-46-2, is a derivative of the amino acid L-cysteine, which is known for its role in protein synthesis and as a precursor to the antioxidant glutathione. This compound features an N-acetyl group, which enhances its stability and solubility compared to L-cysteine. Methyl N-acetyl-L-cysteinate is typically characterized by its white crystalline appearance and is soluble in polar solvents such as water and alcohols. It exhibits properties typical of thiols, including the ability to form disulfide bonds, which are crucial in biological systems. The compound is often studied for its potential applications in pharmaceuticals and biochemistry, particularly in the context of antioxidant activity and cellular protection. Additionally, it may play a role in detoxification processes and has been investigated for its potential therapeutic effects in various health conditions. As with many chemical substances, handling should be done with care, following appropriate safety protocols.
Formula:C6H11NO3S
InChI:InChI=1/C6H11NO3S/c1-4(8)7-5(3-11)6(9)10-2/h5,11H,3H2,1-2H3,(H,7,8)/t5-/m0/s1
SMILES:CC(=N[C@@H](CS)C(=O)OC)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
L-CYSTEINE,N-ACETYL-, METHYL ESTER
CAS:Formula:C6H11NO3SPurity:97%Color and Shape:SolidMolecular weight:177.2214(R)-Methyl 2-Acetamido-3-Mercaptopropanoate
CAS:(R)-Methyl 2-Acetamido-3-MercaptopropanoatePurity:97%Molecular weight:177.22g/molN-Acetyl-L-cysteine Methyl Ester
CAS:Controlled ProductFormula:C6H11NO3SColor and Shape:NeatMolecular weight:177.22Methyl acetyl-L-cysteinate
CAS:Methyl acetyl-L-cysteinate (N-Acetyl-L-cysteine methyl ester) is a cysteine derivative that is used in biosynthesis and is associated with body metabolism andFormula:C6H11NO3SPurity:99.04%Color and Shape:SolidMolecular weight:177.22(R)-Methyl 2-acetamido-3-mercaptopropanoate
CAS:Purity:97%Color and Shape:SolidMolecular weight:177.2200012N-Acetyl-L-cysteine methyl ester
CAS:N-Acetyl-L-cysteine methyl ester (NACME) is a reactive compound that is the methyl ester of cysteine. It belongs to the group of amides and is an important component of human serum. NACME has been shown to be effective in inhibiting the growth of bacteria such as Staphylococcus aureus, Salmonella enterica, Escherichia coli, and Pseudomonas aeruginosa. The mechanism by which NACME inhibits bacterial growth is not yet known, but it may involve oxidative reactions or irreversible inhibition of enzymes.
Formula:C6H11NO3SPurity:Min. 95%Molecular weight:177.22 g/mol







