CymitQuimica logo

CAS 76523-24-5

:

4-fluorobenzylurea

Description:
4-Fluorobenzylurea is an organic compound characterized by the presence of a urea functional group attached to a 4-fluorobenzyl moiety. Its molecular structure features a benzene ring substituted with a fluorine atom at the para position relative to the benzyl group. This compound typically exhibits properties common to ureas, such as being a solid at room temperature and having moderate solubility in polar solvents due to the presence of the urea group, which can engage in hydrogen bonding. The fluorine substitution can influence its reactivity and biological activity, potentially enhancing lipophilicity and altering interaction with biological targets. 4-Fluorobenzylurea may be utilized in various applications, including medicinal chemistry and as a building block in the synthesis of more complex molecules. Its specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which it is studied. As with any chemical substance, proper safety measures should be observed when handling 4-fluorobenzylurea.
Formula:C8H9FN2O
InChI:InChI=1/C8H9FN2O/c9-7-3-1-6(2-4-7)5-11-8(10)12/h1-4H,5H2,(H3,10,11,12)
SMILES:c1cc(ccc1CNC(=N)O)F
Synonyms:
  • 1-(4-Fluorobenzyl)Urea
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.