CymitQuimica logo

CAS 76523-40-5

:

2,3,7,8-tetrachloro(~13~C_12_)oxanthrene

Description:
2,3,7,8-tetrachlorooxanthrene, identified by CAS number 76523-40-5, is a chlorinated aromatic compound known for its environmental persistence and potential toxicity. This substance features a polycyclic structure with four chlorine atoms substituted at the 2, 3, 7, and 8 positions of the oxanthrene framework, which contributes to its stability and resistance to degradation. It is often studied in the context of environmental chemistry due to its occurrence as a contaminant in various ecosystems, particularly in relation to industrial processes and waste. The presence of chlorine atoms enhances its lipophilicity, leading to bioaccumulation in living organisms. Toxicological studies have indicated that compounds of this nature may exhibit endocrine-disrupting properties and can pose risks to human health and wildlife. As a result, 2,3,7,8-tetrachlorooxanthrene is subject to regulatory scrutiny, and its environmental impact is a significant area of research within the fields of toxicology and environmental science.
Formula:C12H4Cl4O2
InChI:InChI=1/C12H4Cl4O2/c13-5-1-9-10(2-6(5)14)18-12-4-8(16)7(15)3-11(12)17-9/h1-4H/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1
InChI key:InChIKey=HGUFODBRKLSHSI-WCGVKTIYSA-N
SMILES:Cl[13C]=1[13CH]=[13C]2[13C](O[13C]=3[13C](O2)=[13CH][13C](Cl)=[13C](Cl)[13CH]3)=[13CH][13C]1Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.