CymitQuimica logo

CAS 76526-29-9

:

2-(2,5-dimethoxybenzoyl)benzoic acid

Description:
2-(2,5-Dimethoxybenzoyl)benzoic acid, identified by its CAS number 76526-29-9, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and a dimethoxy-substituted benzoyl group. This compound typically exhibits properties associated with aromatic carboxylic acids, such as moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic rings. The presence of methoxy groups enhances its electron-donating characteristics, potentially influencing its reactivity and interaction with other chemical species. It may also exhibit interesting photophysical properties, making it of interest in various applications, including organic synthesis and materials science. Additionally, the compound's structure suggests potential for hydrogen bonding due to the carboxylic acid functional group, which could affect its behavior in different environments. Overall, 2-(2,5-dimethoxybenzoyl)benzoic acid is a versatile compound with potential applications in pharmaceuticals and organic chemistry.
Formula:C16H14O5
InChI:InChI=1/C16H14O5/c1-20-10-7-8-14(21-2)13(9-10)15(17)11-5-3-4-6-12(11)16(18)19/h3-9H,1-2H3,(H,18,19)
SMILES:COc1ccc(c(c1)C(=O)c1ccccc1C(=O)O)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.