CAS 765291-41-6

N-(4-amino-2-methylphenyl)-2,2-dimethylpropanamide

Description:

N-(4-amino-2-methylphenyl)-2,2-dimethylpropanamide, with the CAS number 765291-41-6, is an organic compound characterized by its amide functional group, which is derived from the reaction of an amine and a carboxylic acid. This compound features a 2,2-dimethylpropanamide backbone, providing steric hindrance that can influence its reactivity and solubility. The presence of the 4-amino-2-methylphenyl group contributes to its potential biological activity, as amino groups can participate in hydrogen bonding and enhance interactions with biological targets. The molecular structure suggests that it may exhibit moderate polarity, affecting its solubility in various solvents. Additionally, the compound's specific stereochemistry and substituents can influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME). Overall, N-(4-amino-2-methylphenyl)-2,2-dimethylpropanamide may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, but further studies would be necessary to elucidate its full biological profile and potential uses.

Formula: C₁₂H₁₈N₂O

InChI: InChI=1/C12H18N2O/c1-8-7-9(13)5-6-10(8)14-11(15)12(2,3)4/h5-7H,13H2,1-4H3,(H,14,15)

SMILES: Cc1cc(ccc1NC(=O)C(C)(C)C)N