CAS 76530-44-4
:Azamulin
Description:
Azamulin is a synthetic compound classified as a potent inhibitor of cytochrome P450 enzymes, particularly CYP3A4, which plays a crucial role in drug metabolism. It is primarily used in pharmacological research to study drug interactions and metabolic pathways. Azamulin exhibits a complex structure that includes a fused bicyclic system, contributing to its biological activity. The compound is known for its ability to modulate the metabolism of various drugs, making it significant in the field of toxicology and pharmacokinetics. In addition to its role as an enzyme inhibitor, Azamulin has been investigated for its potential therapeutic applications, although it is not widely used in clinical settings. Its solubility and stability in various solvents can vary, influencing its bioavailability and efficacy in experimental conditions. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards in laboratory environments. Overall, Azamulin serves as an important tool in understanding drug metabolism and interactions within biological systems.
Formula:C24H38N4O4S
InChI:InChI=1/C24H38N4O4S/c1-6-22(4)11-16(32-17(30)12-33-21-26-20(25)27-28-21)23(5)13(2)7-9-24(14(3)19(22)31)10-8-15(29)18(23)24/h13-14,16,18-19,31H,6-12H2,1-5H3,(H3,25,26,27,28)/t13?,14-,16+,18-,19-,22+,23-,24-/m0/s1
Synonyms:- Azamulin [INN]
- ((5-Amino-s-triazol-3-yl)thio)acetic acid, 8-ester with (3aS,4R,5S,6R,8R,9R,9aR,10R)-6-ethyloctahydro-5,8-dihydroxy-4,6,9,10-tetramethyl-3a,9-propano-3aH-cyclopentacycloocten-1(4H)-one
- ((5-Amino-s-triazol-3-yl)thio)acetic acid, 8-ester with (3aS,4R,5S,6R,8R,9aR,10R)-6-ethyloctahydro-5,8-dihydroxy-4,6,9,10-tetramethyl-3a,9-propano-3aH-cyclopentacycloocten-1(4H)-one
- (3aS,4R,5S,6R,8R,9R,9aR,10R)-6-Ethyldecahydro-5-hydroxy-4,6,9,10-tetramethyl-1-oxo-3a,9-propanocyclopentacycloocten-8-yl ((5-amino-1,2,4-triazol-3-yl)thio)acetat
- Azamulinum
- Unii-875Aq866X1
- (3aS,4R,5S,6R,8R,9R,9aR)-6-ethyl-5-hydroxy-4,6,9,10-tetramethyl-1-oxodecahydro-3a,9-propanocyclopenta[8]annulen-8-yl [(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Azamulin
CAS:Azamulin is a semi-synthetic antibiotic belonging to the class of pleuromutilins, which is derived from natural fermentation products of the basidiomycete fungi genus Clitopilus. Its mode of action involves potent selective inhibition of cytochrome P450 3A4 enzymes. This enzyme family is essential for the oxidation of organic substances, and Azamulin's role as an inhibitor makes it valuable for studying drug metabolism and interactions in vitro.Formula:C24H38N4O4SPurity:Min. 95%Color and Shape:SolidMolecular weight:478.65 g/mol



