CymitQuimica logo

CAS 76530-89-7

:

(2E)-1,3-bis(1,3-benzodioxol-5-yl)prop-2-en-1-one

Description:
(2E)-1,3-bis(1,3-benzodioxol-5-yl)prop-2-en-1-one, also known as a derivative of chalcone, is an organic compound characterized by its unique structure that features two benzodioxole moieties attached to a prop-2-en-1-one backbone. This compound typically exhibits a yellow to orange color and is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties. The presence of the benzodioxole groups contributes to its stability and reactivity, making it a subject of interest in medicinal chemistry and natural product synthesis. Its molecular structure allows for various interactions with biological targets, which can lead to diverse pharmacological effects. Additionally, this compound may be soluble in organic solvents, and its reactivity can be influenced by the presence of functional groups and the overall electronic environment. As with many organic compounds, its properties can vary based on factors such as purity, solvent interactions, and environmental conditions.
Formula:C17H12O5
InChI:InChI=1/C17H12O5/c18-13(12-3-6-15-17(8-12)22-10-20-15)4-1-11-2-5-14-16(7-11)21-9-19-14/h1-8H,9-10H2/b4-1+
Synonyms:
  • 2-propen-1-one, 1,3-bis(1,3-benzodioxol-5-yl)-, (2E)-
  • (2E)-1,3-Bis(1,3-benzodioxol-5-yl)prop-2-en-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.