CAS 76532-35-9

1-(4-methoxynaphthalen-1-yl)-N-methylmethanamine

Description:

1-(4-Methoxynaphthalen-1-yl)-N-methylmethanamine, with the CAS number 76532-35-9, is an organic compound characterized by its structure, which includes a naphthalene ring substituted with a methoxy group and an N-methylmethanamine moiety. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine functional group. The methoxy group can influence the electronic properties of the naphthalene ring, potentially enhancing its reactivity in electrophilic substitution reactions. Additionally, the presence of the N-methyl group may affect the compound's basicity and steric hindrance. This substance may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing more complex molecules. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.

Formula: C₁₃H₁₅NO

InChI: InChI=1/C13H15NO/c1-14-9-10-7-8-13(15-2)12-6-4-3-5-11(10)12/h3-8,14H,9H2,1-2H3

SMILES: CNCc1ccc(c2ccccc12)OC

Synonyms:

• (4-Methoxy-1-naphthyl)-N-methylmethanamine
• 4-Methoxy-N-methyl-1-naphthalenemethanamine