CymitQuimica logo

CAS 76537-23-0

:

6-chloroimidazo[1,2-a]pyrazine

Description:
6-Chloroimidazo[1,2-a]pyrazine is a heterocyclic organic compound characterized by its fused imidazole and pyrazine rings, with a chlorine substituent at the 6-position of the imidazole ring. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the chlorine atom can influence its reactivity and solubility, often enhancing its lipophilicity. The compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the chlorine atom. Its structure allows for potential interactions with biological targets, which can be explored in pharmacological studies. Additionally, 6-chloroimidazo[1,2-a]pyrazine may serve as a building block in the synthesis of more complex molecules, contributing to the development of novel therapeutic agents. As with many heterocycles, it is important to handle this compound with care, considering safety and environmental regulations.
Formula:C6H4ClN3
InChI:InChI=1/C6H4ClN3/c7-5-4-10-2-1-8-6(10)3-9-5/h1-4H
InChI key:PTWXEVLXAHFMKK-UHFFFAOYSA-N
SMILES:c1cn2cc(Cl)ncc2n1
Synonyms:
  • imidazo[1,2-a]pyrazine, 6-chloro-6-Chloro-Imidazo[1,2-A]Pyrazine
Found 5 products.