CAS 76541-60-1

Phosphonic acid, [2-(4-chlorophenoxy)ethyl]-, dimethyl ester

Description:

Phosphonic acid, [2-(4-chlorophenoxy)ethyl]-, dimethyl ester, with CAS number 76541-60-1, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group and two methyl ester groups. This compound typically exhibits properties associated with phosphonates, such as being a potential herbicide or pesticide due to its ability to interfere with metabolic processes in plants. The presence of the 4-chlorophenoxy group suggests that it may have specific biological activity, possibly acting as a growth regulator or herbicide. In terms of physical properties, phosphonic acids often have moderate solubility in water and organic solvents, and they can be sensitive to hydrolysis, especially under acidic or basic conditions. The compound may also exhibit stability under certain conditions, making it useful in agricultural applications. Safety data should be consulted for handling and exposure guidelines, as organophosphorus compounds can have varying degrees of toxicity. Overall, this compound's unique structure contributes to its potential utility in various chemical and agricultural applications.

Formula: C₁₀H₁₄ClO₄P

InChI: InChI=1S/C10H14ClO4P/c1-13-16(12,14-2)8-7-15-10-5-3-9(11)4-6-10/h3-6H,7-8H2,1-2H3

InChI key: InChIKey=UBWNBCHFSJMNBP-UHFFFAOYSA-N

SMILES: O(CCP(OC)(OC)=O)C1=CC=C(Cl)C=C1

Synonyms:

• Phosphonic acid, [2-(4-chlorophenoxy)ethyl]-, dimethyl ester