CymitQuimica logo

CAS 76546-68-4

:

ethyl 2,5-dimethyl-1-phenyl-1H-pyrrole-3-carboxylate

Description:
Ethyl 2,5-dimethyl-1-phenyl-1H-pyrrole-3-carboxylate is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an ethyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of two methyl groups at the 2 and 5 positions of the pyrrole ring, along with a phenyl group at the 1 position, enhances its steric and electronic properties, potentially influencing its reactivity and interactions with other molecules. The carboxylate group at the 3 position further adds to its chemical versatility, making it a candidate for various synthetic applications, including in pharmaceuticals and agrochemicals. The compound's molecular structure suggests it may exhibit interesting biological activities, although specific biological data would require further investigation. Overall, ethyl 2,5-dimethyl-1-phenyl-1H-pyrrole-3-carboxylate is a complex molecule with potential utility in organic synthesis and medicinal chemistry.
Formula:C15H17NO2
InChI:InChI=1/C15H17NO2/c1-4-18-15(17)14-10-11(2)16(12(14)3)13-8-6-5-7-9-13/h5-10H,4H2,1-3H3
SMILES:CCOC(=O)c1cc(C)n(c1C)c1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.