CAS 76548-27-1

(3aR,4S,7R)-4,7-dihydroxy-6-(hydroxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one

Description:

The chemical substance known as (3aR,4S,7R)-4,7-dihydroxy-6-(hydroxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-one, with the CAS number 76548-27-1, is a complex organic compound characterized by its unique bicyclic structure that incorporates a dioxole and pyran moiety. This compound features multiple hydroxyl groups, which contribute to its hydrophilicity and potential reactivity. The stereochemistry indicated by the (3aR,4S,7R) configuration suggests specific spatial arrangements of its substituents, which can influence its biological activity and interactions. The presence of hydroxymethyl and dihydroxy groups may enhance its solubility in polar solvents and could play a role in its function as a potential bioactive molecule. Such compounds are often of interest in medicinal chemistry and natural product synthesis, where their structural complexity may lead to diverse pharmacological properties. Overall, this substance exemplifies the intricate relationship between molecular structure and chemical behavior in organic compounds.

Formula: C₇H₁₀O₇

InChI: InChI=1/C7H10O7/c8-1-2-3(9)4-5(6(10)12-2)14-7(11)13-4/h2-6,8-10H,1H2/t2?,3-,4?,5-,6+/m1/s1

2,3-O-Carbonyl-α-D-mannopyranose

CAS: 76548-27-1

Molecular weight: 206.15

Ref: 7W-GC4551

2,3-O-Carbonyl-α-D-mannofuranose

CAS: 76548-27-1

2,3-O-Carbonyl-α-D-mannofuranose

Color and Shape: Liquid

Molecular weight: 206.15g/mol

Ref: 54-BICL2158

2,3-O-Carbonyl-a-D-mannopyranose

CAS: 76548-27-1

2,3-O-Carbonyl-a-D-mannopyranose is a modified sugar that can be synthesized from D-mannose. It is used to produce oligosaccharides and polysaccharides. This compound has been shown to be useful for the fluorination of proteins and for click modification reactions. 2,3-O-Carbonyl-a-D-mannopyranose has high purity and can be custom synthesized for quality assurance purposes.

Formula: C₇H₁₀O₇

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 206.15 g/mol

Ref: 3D-MC04676