CAS 76550-42-0

1,3-Naphthalenedisulfonic acid, 4-amino-5-hydroxy-, sodium salt (1:?)

Description:

1,3-Naphthalenedisulfonic acid, 4-amino-5-hydroxy-, sodium salt (CAS 76550-42-0) is an organic compound characterized by its naphthalene backbone with two sulfonic acid groups and an amino group, along with a hydroxyl group. This compound typically appears as a solid and is soluble in water due to the presence of the sulfonate groups, which enhance its ionic character. It is often used as a dye intermediate and in various applications in the textile and paper industries. The presence of both amino and hydroxyl functional groups suggests potential for reactivity, allowing it to participate in various chemical reactions, including coupling reactions in dye synthesis. Additionally, the sodium salt form indicates that it is neutralized with sodium, which can influence its solubility and stability in different environments. Overall, this compound is significant in industrial applications, particularly in the production of colorants and other chemical products.

Formula: C₁₀H₉NO₇S₂·xNa

InChI: InChI=1S/C10H9NO7S2.Na/c11-10-8(20(16,17)18)4-7(19(13,14)15)5-2-1-3-6(12)9(5)10;/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18);

InChI key: InChIKey=HSHVRMUYOUKKOM-UHFFFAOYSA-N

SMILES: NC=1C2=C(C(S(=O)(=O)O)=CC1S(=O)(=O)O)C=CC=C2O.[Na]

Synonyms:

• 1,3-Naphthalenedisulfonic acid, 4-amino-5-hydroxy-, sodium salt
• 1,3-Naphthalenedisulfonic acid, 4-amino-5-hydroxy-, sodium salt (1:?)

1,3-Naphthalenedisulfonic acid, 4-amino-5-hydroxy-, sodium salt (1:?)

CAS: 76550-42-0

Formula: C₁₀H₉NNaO₇S₂

Molecular weight: 342.3007

Ref: IN-DA01X3D8