CAS 7656-99-7

2,3,5,6-Tetrachlorobenzotrifluoride

Description:

2,3,5,6-Tetrachlorobenzotrifluoride, with the CAS number 7656-99-7, is a chlorinated aromatic compound characterized by the presence of four chlorine atoms and three fluorine atoms attached to a benzene ring. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its stability and resistance to degradation, making it useful in various industrial applications, including as a solvent and in the synthesis of other chemical compounds. The presence of multiple halogen substituents contributes to its chemical reactivity, particularly in nucleophilic substitution reactions. Additionally, it is important to handle this substance with care due to its potential environmental and health impacts, as many chlorinated compounds can be toxic or persistent in the environment. Proper safety measures should be taken when working with this chemical, including the use of personal protective equipment and adherence to regulatory guidelines for hazardous substances.

Formula: C₇HCl₄F₃

InChI: InChI=1/C7HCl4F3/c8-2-1-3(9)6(11)4(5(2)10)7(12,13)14/h1H

SMILES: c1c(c(c(c(c1Cl)Cl)C(F)(F)F)Cl)Cl