CAS 76561-16-5

4-Bromoisatoic anhydride

Description:

4-Bromoisatoic anhydride is an organic compound characterized by its anhydride functional group derived from isatoic acid, with a bromine atom substituted at the para position of the aromatic ring. This compound typically appears as a white to off-white solid and is known for its reactivity, particularly in acylation reactions due to the presence of the anhydride group. It is often utilized in organic synthesis, especially in the preparation of various derivatives and in the development of pharmaceuticals. The presence of the bromine atom can enhance electrophilic reactivity, making it a useful intermediate in synthetic pathways. Additionally, 4-Bromoisatoic anhydride may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its solubility characteristics can vary, often being soluble in organic solvents while having limited solubility in water. As with many chemical substances, proper storage conditions are essential to maintain its stability and prevent degradation.

Formula: C₈H₄BrNO₃

InChI: InChI=1/C8H4BrNO3/c9-4-1-2-5-6(3-4)10-8(12)13-7(5)11/h1-3H,(H,10,12)

SMILES: c1cc2c(cc1Br)nc(O)oc2=O

Synonyms:

• 7-Bromo-1H-benzo[d][1,3]oxazine-2,4-dione
• 7-Bromo-2H-3,1-benzoxazine-2,4(1H)-dione

7-Bromo-1H-benzo[d][1,3]oxazine-2,4-dione

CAS: 76561-16-5

Formula: C₈H₄BrNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 242.0263

Ref: IN-DA005KGY

4-Bromoisatoic anhydride

CAS: 76561-16-5

4-Bromoisatoic anhydride

Formula: C₈H₄BrNO₃

Purity: 97%

Color and Shape: pale cream. wooly. small crystalline flakes

Molecular weight: 242.02626g/mol

Ref: 54-OR400015

4-Bromoisatoic anhydride

CAS: 76561-16-5

Formula: C₈H₄BrNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 242.028

Ref: 10-F223680