CAS 76567-27-6
:N-[(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)methyl]-L-glutamic acid
Description:
N-[(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)methyl]-L-glutamic acid, with the CAS number 76567-27-6, is a chemical compound that features a pyrimidine ring fused with a glutamic acid moiety. This compound is characterized by its unique structure, which includes a tetrahydropyrimidine core that contributes to its biological activity. The presence of two carbonyl groups (dioxo) enhances its reactivity and potential interactions with biological targets. As a derivative of glutamic acid, it may exhibit properties related to neurotransmission and metabolic processes. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. It is important in medicinal chemistry and may serve as a lead compound for the development of pharmaceuticals, particularly in the context of neurological disorders or metabolic diseases. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications in drug development.
Formula:C10H13N3O6
InChI:InChI=1/C10H13N3O6/c14-7(15)2-1-6(9(17)18)11-3-5-4-12-10(19)13-8(5)16/h4,6,11H,1-3H2,(H,14,15)(H,17,18)(H2,12,13,16,19)/t6-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
α-Glutamylthymine
CAS:<p>alpha-Glutamylthymine is a hypermodified base for DNA.</p>Formula:C10H13N3O6Color and Shape:SolidMolecular weight:271.23
