CAS 76568-68-8

7-fluoro-1-methyl-3-(methylsulfonyl)quinolin-4(1H)-one

Description:

7-Fluoro-1-methyl-3-(methylsulfonyl)quinolin-4(1H)-one is a synthetic organic compound characterized by its quinoline core structure, which is a bicyclic aromatic compound known for its diverse biological activities. The presence of a fluorine atom at the 7-position enhances its lipophilicity and may influence its pharmacological properties. The methylsulfonyl group at the 3-position contributes to the compound's solubility and reactivity, potentially impacting its interaction with biological targets. This compound is typically studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural features that may exhibit antimicrobial, anti-inflammatory, or anticancer activities. Its molecular structure allows for various modifications, which can lead to derivatives with enhanced efficacy or reduced toxicity. As with many quinoline derivatives, the compound's behavior in biological systems, including its absorption, distribution, metabolism, and excretion (ADME) properties, is crucial for understanding its therapeutic potential.

Formula: C₁₁H₁₀FNO₃S

InChI: InChI=1/C11H10FNO3S/c1-13-6-10(17(2,15)16)11(14)8-4-3-7(12)5-9(8)13/h3-6H,1-2H3

SMILES: Cn1cc(c(=O)c2ccc(cc12)F)S(=O)(=O)C

Synonyms:

• 4(1H)-Quinolinone, 7-fluoro-1-methyl-3-(methylsulfonyl)-
• 7-Fluoro-1-methyl-3-methylsulfonyl-4-quinolone