
CAS 76572-47-9
:2-Butyl-4-methylthiazole
Description:
2-Butyl-4-methylthiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a butyl group and a methyl group attached to the thiazole ring, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a distinctive odor, often described as earthy or nutty. The presence of the thiazole moiety imparts certain biological activities, making it of interest in various fields, including flavor and fragrance industries, as well as potential applications in pharmaceuticals. Its molecular structure allows for moderate solubility in organic solvents, while its volatility can vary based on environmental conditions. Safety data indicates that, like many thiazole derivatives, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 2-Butyl-4-methylthiazole is a compound with notable chemical characteristics and applications, warranting further exploration in both industrial and research contexts.
Formula:C8H13NS
InChI:InChI=1S/C8H13NS/c1-3-4-5-8-9-7(2)6-10-8/h6H,3-5H2,1-2H3
InChI key:InChIKey=HVRMJTCTZVGJDO-UHFFFAOYSA-N
SMILES:C(CCC)C1=NC(C)=CS1
Synonyms:- Thiazole, 2-butyl-4-methyl-
- 2-Butyl-4-methylthiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.