CAS 76577-82-7

ethyl pyrrolo[1,2-a]quinoline-2-carboxylate

Description:

Ethyl pyrrolo[1,2-a]quinoline-2-carboxylate is a chemical compound characterized by its unique bicyclic structure, which combines a pyrrole and a quinoline moiety. This compound typically exhibits a molecular formula that reflects its complex arrangement of carbon, hydrogen, nitrogen, and oxygen atoms. Ethyl pyrrolo[1,2-a]quinoline-2-carboxylate is often recognized for its potential biological activities, which may include antimicrobial or anticancer properties, making it of interest in medicinal chemistry. The presence of the ethyl ester group contributes to its solubility and reactivity, allowing for various synthetic modifications. Additionally, the compound's structure may influence its interaction with biological targets, leading to diverse pharmacological effects. As with many organic compounds, its stability, reactivity, and potential applications can vary based on environmental conditions and the presence of other chemical species. Safety data and handling precautions are essential when working with this compound, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₅H₁₃NO₂

InChI: InChI=1/C15H13NO2/c1-2-18-15(17)12-9-13-8-7-11-5-3-4-6-14(11)16(13)10-12/h3-10H,2H2,1H3

SMILES: CCOC(=O)c1cc2ccc3ccccc3n2c1

Synonyms:

• Ethylpyrrolo[1,2-a]chinolin-2-carboxylat
• Pyrrolo[1,2-A]Quinoline-2-Carboxylic Acid, Ethyl Ester

Ethyl pyrrolo[1,2-a]quinoline-2-carboxylate

CAS: 76577-82-7

Ethyl pyrrolo[1,2-a]quinoline-2-carboxylate

Purity: ≥95%

Molecular weight: 239.27g/mol

Ref: 54-OR1373