CAS 76578-13-7
:Quizalofop-methyl
Description:
Quizalofop-methyl is a selective post-emergence herbicide primarily used for controlling grassy weeds in various crops, particularly in broadleaf crops. It belongs to the aryloxyphenoxypropionate class of herbicides and functions by inhibiting the enzyme acetyl-CoA carboxylase, which is crucial for fatty acid synthesis in plants. This inhibition leads to the disruption of cell membrane integrity and ultimately plant death. Quizalofop-methyl is characterized by its systemic action, allowing it to be absorbed by the foliage and translocated throughout the plant. It is typically applied in liquid formulations and is known for its effectiveness against a range of annual and perennial grass species. The compound is relatively stable under normal environmental conditions but can degrade in the presence of sunlight and moisture. Safety assessments indicate that, when used according to label directions, it poses minimal risk to non-target organisms, including humans and wildlife. However, like all pesticides, it should be handled with care, following appropriate safety guidelines to mitigate any potential risks.
Formula:C18H15ClN2O4
InChI:InChI=1S/C18H15ClN2O4/c1-11(18(22)23-2)24-13-4-6-14(7-5-13)25-17-10-20-16-9-12(19)3-8-15(16)21-17/h3-11H,1-2H3
InChI key:InChIKey=YGHJGQYNECSZDY-UHFFFAOYSA-N
SMILES:O(C1=NC2=C(N=C1)C=C(Cl)C=C2)C3=CC=C(OC(C(OC)=O)C)C=C3
Synonyms:- Propanoic acid, 2-(4-((6-chloro-2-quinoxalinyl)oxy)phenoxy)-, methyl ester
- Quizalofop-methyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Quizalofop-methyl
CAS:Controlled ProductFormula:C18H15ClN2O4Color and Shape:NeatMolecular weight:358.78
