CAS 76579-64-1

3-(2-bromophenoxy)-N,N-dimethylpropan-1-amine

Description:

3-(2-Bromophenoxy)-N,N-dimethylpropan-1-amine, with the CAS number 76579-64-1, is an organic compound characterized by its unique structure that includes a bromophenyl group and a dimethylamino group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the bromine atom in the phenoxy group can impart specific reactivity and influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the dimethylamino group enhances its lipophilicity, potentially affecting its pharmacokinetic properties. The compound may be used in research settings, particularly in studies related to neurotransmitter systems or as a precursor in the synthesis of other chemical entities. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, this compound's characteristics make it a subject of interest in both synthetic and applied chemistry.

Formula: C₁₁H₁₆BrNO

InChI: InChI=1/C11H16BrNO/c1-13(2)8-5-9-14-11-7-4-3-6-10(11)12/h3-4,6-7H,5,8-9H2,1-2H3

SMILES: CN(C)CCCOc1ccccc1Br

Synonyms:

• 3-(4-bromophenoxy)-N,N-dimethylpropan-1-amine

3-(4-Bromophenoxy)-N,N-dimethylpropylamine

CAS: 76579-64-1

3-(4-Bromophenoxy)-N,N-dimethylpropylamine

Purity: 95

Molecular weight: 258.15g/mol

Ref: 54-OR55320