CAS 7658-10-8

6-deoxy-D-talose

Description:

6-Deoxy-D-talose is a monosaccharide, specifically a hexose, that is characterized by the absence of a hydroxyl group at the sixth carbon atom in its structure. This modification classifies it as a deoxy sugar. It is an epimer of D-talose, differing in configuration at the C-6 position. The molecular formula of 6-deoxy-D-talose is C6H12O5, and it typically exists in a cyclic form, predominantly as a pyranose. This sugar is less common than its counterparts and is of interest in various biochemical and synthetic applications, particularly in the study of glycosylation and carbohydrate chemistry. Its properties include being soluble in water and exhibiting a sweet taste, typical of many sugars. Additionally, 6-deoxy-D-talose can participate in various chemical reactions, including oxidation and reduction, making it a valuable compound in organic synthesis and research. Its CAS number, 7658-10-8, is a unique identifier that facilitates its identification in chemical databases and literature.

Formula: C₆H₁₂O₅

InChI: InChI=1/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4-,5+,6-/m1/s1

6-Deoxy-L-talose

CAS: 7658-10-8

Molecular weight: 164.16

Ref: 7W-GC9791

6-Deoxy-L-talose

CAS: 7658-10-8

Applications 6-Deoxy-L-talose (cas# 7658-10-8) is a compound useful in organic synthesis.
References Jolles, P., et al.: Bull. Soc. Chim Biol., 43, 177 (1961), Chaput, G., et al.: Experientia, 17, 107 (1961)

Formula: C₆H₁₂O₅

Color and Shape: Neat

Molecular weight: 164.16

Ref: TR-D275000

6-Deoxy-L-talose

CAS: 7658-10-8

6-Deoxy-L-talose is a sugar that is found in the cell walls of bacteria. It is a component of glycan, which are long chains of sugar molecules linked together. Glycans are important for the structural integrity and function of bacterial cell walls. 6-Deoxy-L-talose is a monosaccharide that has been detected in the type strain of Bacillus subtilis and in wild-type strains of Pseudomonas aeruginosa. This sugar can be chemically analyzed using gas chromatography and mass spectrometry to determine its structure and chemical composition. 6-Deoxy-L-talose can be used to detect specific monoclonal antibodies against it, which could be useful for detecting bacterial infections or determining how antibiotics affect bacteria.

Formula: C₆H₁₂O₅

Purity: Min. 98 Area-%

Color and Shape: White Powder

Molecular weight: 164.16 g/mol

Ref: 3D-MD04657