CAS 76590-51-7

4-(Aminocarbonyl)-α-oxobenzeneacetic acid

Description:

4-(Aminocarbonyl)-α-oxobenzeneacetic acid, also known by its CAS number 76590-51-7, is an organic compound characterized by the presence of both an amino group and a carbonyl group within its structure. This compound features a benzene ring substituted with an α-oxobenzeneacetic acid moiety, which contributes to its acidic properties. The amino group enhances its potential for forming hydrogen bonds, making it soluble in polar solvents. The presence of the carbonyl group indicates that it can participate in various chemical reactions, such as nucleophilic addition or condensation. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.

Formula: C₉H₇NO₄

InChI: InChI=1S/C9H7NO4/c10-8(12)6-3-1-5(2-4-6)7(11)9(13)14/h1-4H,(H2,10,12)(H,13,14)

InChI key: InChIKey=LEPQVNVWELCKPB-UHFFFAOYSA-N

SMILES: C(C(O)=O)(=O)C1=CC=C(C(N)=O)C=C1

Synonyms:

• 2-(4-Carbamoylphenyl)-2-oxoacetic acid
• 4-(Aminocarbonyl)-α-oxobenzeneacetic acid
• Benzeneacetic acid, 4-(aminocarbonyl)-α-oxo-