
CAS 765926-19-0
:2,4-Dichloro-6-(3-methyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzenamine
Description:
2,4-Dichloro-6-(3-methyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzenamine is a chemical compound characterized by its complex structure, which includes a dichlorobenzene moiety and a triazole-thiadiazole ring system. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical and agricultural applications. The presence of chlorine atoms in the benzene ring can influence its reactivity and stability, while the triazole-thiadiazole component may contribute to its biological activity, possibly as a fungicide or herbicide. The compound's molecular structure suggests it may interact with biological targets, potentially leading to various pharmacological effects. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography. Safety and handling precautions are essential due to the presence of halogenated compounds, which can pose environmental and health risks. Overall, this compound represents a unique class of chemical entities with potential applications in various fields.
Formula:C10H7Cl2N5S
InChI:InChI=1S/C10H7Cl2N5S/c1-4-14-15-10-17(4)16-9(18-10)6-2-5(11)3-7(12)8(6)13/h2-3H,13H2,1H3
InChI key:InChIKey=SNPDJDJHMBPTPY-UHFFFAOYSA-N
SMILES:NC1=C(C2=NN3C(S2)=NN=C3C)C=C(Cl)C=C1Cl
Synonyms:- Benzenamine, 2,4-dichloro-6-(3-methyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-
- 2,4-Dichloro-6-(3-methyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.