CAS 766-16-5
:4-fluoro-2-methylpyridine
Description:
4-Fluoro-2-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a fluorine atom at the 4-position and a methyl group at the 2-position. Its molecular formula is C6H6FN, indicating the presence of six carbon atoms, six hydrogen atoms, one fluorine atom, and one nitrogen atom. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is polar in nature due to the electronegative fluorine and nitrogen atoms, which can influence its solubility in various solvents. 4-Fluoro-2-methylpyridine is known for its applications in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals, owing to its ability to act as a building block in the synthesis of more complex molecules. Additionally, it exhibits moderate toxicity and should be handled with care, following appropriate safety protocols. Its reactivity can be attributed to the presence of the nitrogen atom in the aromatic ring, which can participate in various chemical reactions, including electrophilic substitution and nucleophilic attacks.
Formula:C6H6FN
InChI:InChI=1/C6H6FN/c1-5-4-6(7)2-3-8-5/h2-4H,1H3
SMILES:Cc1cc(ccn1)F
Synonyms:- Pyridine, 4-Fluoro-2-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Fluoro-2-methylpyridine, 96%
CAS:It is used in the correlations with and limitations of the scale of solvent hydrogen bond donor acidities. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original AlfFormula:C6H6FNPurity:96%Molecular weight:111.124-Fluoro-2-methylpyridine
CAS:Formula:C6H6FNPurity:97%Color and Shape:LiquidMolecular weight:111.11694-Fluoro-2-methylpyridine
CAS:4-Fluoro-2-methylpyridineFormula:C6H6FNPurity:97%Color and Shape: clear. almost colourless liquidMolecular weight:111.12g/mol4-Fluoro-2-methylpyridine
CAS:Formula:C6H6FNPurity:>97%Color and Shape:LiquidMolecular weight:111.119



