CAS 766-47-2
:1-ethynyl-2-methylbenzene
Description:
1-Ethynyl-2-methylbenzene, also known as 2-methylphenylacetylene, is an organic compound characterized by its alkyne functional group and aromatic ring structure. It features a phenyl group substituted with a methyl group and an ethynyl group at the ortho position. This compound is typically a colorless to pale yellow liquid with a distinct aromatic odor. It is relatively insoluble in water but soluble in organic solvents such as ethanol and ether. The presence of the ethynyl group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the production of pharmaceuticals and other complex organic molecules. Additionally, 1-ethynyl-2-methylbenzene can undergo various reactions, including electrophilic aromatic substitution and coupling reactions, due to the electron-rich nature of the aromatic ring. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested, and proper storage conditions should be maintained to prevent degradation.
Formula:C9H8
InChI:InChI=1/C9H8/c1-3-9-7-5-4-6-8(9)2/h1,4-7H,2H3
SMILES:C#Cc1ccccc1C
Synonyms:- 2-Methyl phenylacetylene
- 2-Ethynyltoluene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Methylphenylacetylene
CAS:2-MethylphenylacetyleneFormula:C9H8Purity:95%Color and Shape: clear. colourless liquidMolecular weight:116.16g/mol1-Ethynyl-2-methylbenzene
CAS:Formula:C9H8Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:116.162-Ethynyltoluene
CAS:2-Ethynyltoluene is an organic compound that has been reported to be reactive with various compounds. This chemical has been shown to inhibit the phosphorylation of tyrosine residues on human insulin receptor, which is a key step in insulin signaling pathways. The phosphate group in 2-ethynyl-toluene can be removed by protonation, allowing the molecule to react with other molecules and form model complexes. This chemical also forms polymers when heated and coated onto surfaces.2-Ethynyltoluene is soluble in polar solvents such as water, alcohols, and acetone.
2-Ethynyltoluene has a molecular weight of 130.1 g/mol and a boiling point of 148°C at 760 mmHg.Formula:C9H8Purity:Min. 95%Molecular weight:116.16 g/mol





