CAS 766-49-4
:1-ethynyl-2-fluorobenzene
Description:
1-Ethynyl-2-fluorobenzene, with the CAS number 766-49-4, is an organic compound characterized by the presence of both an ethynyl group and a fluorine atom attached to a benzene ring. This compound features a triple bond between two carbon atoms in the ethynyl group, which contributes to its reactivity and potential applications in organic synthesis. The fluorine atom, being highly electronegative, influences the electronic properties of the molecule, enhancing its polarity and potentially affecting its interactions with other substances. 1-Ethynyl-2-fluorobenzene is typically a colorless to pale yellow liquid and is known for its aromatic properties, which can lead to distinct odor characteristics. It is used in various chemical reactions, including cross-coupling reactions, and serves as an intermediate in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested, and proper storage conditions are essential to maintain its stability.
Formula:C8H5F
InChI:InChI=1/C8H5F/c1-2-7-5-3-4-6-8(7)9/h1,3-6H
SMILES:C#Cc1ccccc1F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Ethynyl-2-fluorobenzene
CAS:Formula:C8H5FPurity:>97.0%(GC)Color and Shape:Colorless to Brown clear liquidMolecular weight:120.132-Fluorophenylacetylene, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H5FPurity:97%Molecular weight:120.122-Fluorophenylacetylene
CAS:2-FluorophenylacetyleneFormula:C8H5FPurity:97%Color and Shape: clear. faint yellow liquidMolecular weight:120.12g/mol2-Fluorophenylacetylene
CAS:Formula:C8H5FPurity:97%Color and Shape:Liquid, Colourless to yellowish liquidMolecular weight:120.126




