CAS 76605-09-9

1-(4-chlorophenyl)-3-fluoropropan-2-amine

Description:

1-(4-Chlorophenyl)-3-fluoropropan-2-amine, also known by its CAS number 76605-09-9, is a chemical compound that belongs to the class of substituted phenylpropylamines. It features a propan-2-amine backbone with a 4-chlorophenyl group and a fluorine atom attached to the propyl chain. This compound is characterized by its potential biological activity, often studied in the context of pharmacology and medicinal chemistry. The presence of the chlorophenyl group may influence its lipophilicity and receptor binding properties, while the fluorine atom can enhance metabolic stability and alter the compound's pharmacokinetics. Typically, such compounds are investigated for their effects on neurotransmitter systems, particularly in relation to the central nervous system. Safety and handling considerations are essential, as with many amines, due to their potential reactivity and toxicity. Overall, 1-(4-chlorophenyl)-3-fluoropropan-2-amine represents a compound of interest in both synthetic and applied chemistry fields.

Formula: C₉H₁₁ClFN

InChI: InChI=1/C9H11ClFN/c10-8-3-1-7(2-4-8)5-9(12)6-11/h1-4,9H,5-6,12H2

SMILES: c1cc(ccc1CC(CF)N)Cl

Synonyms:

• Benzeneethanamine, 4-Chloro-Alpha-(Fluoromethyl)-