CAS 76609-48-8

N-[2-(2-Pyridinyl)ethyl]hydrazinecarbothioamide

Description:

N-[2-(2-Pyridinyl)ethyl]hydrazinecarbothioamide is a chemical compound characterized by its unique structure, which includes a hydrazine moiety and a pyridine ring. This compound features a hydrazine functional group, which is known for its reactivity and ability to form various derivatives. The presence of the pyridine ring contributes to its potential biological activity, as pyridine derivatives are often involved in pharmacological applications. The carbothioamide functional group indicates that the compound may exhibit thiourea-like properties, which can influence its solubility and reactivity. Typically, compounds like this may be investigated for their potential use in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's molecular interactions, stability, and reactivity can be influenced by the presence of functional groups, making it a subject of interest in both synthetic and applied chemistry. Safety and handling precautions should be observed due to the potential hazards associated with hydrazine derivatives.

Formula: C₈H₁₂N₄S

InChI: InChI=1S/C8H12N4S/c9-12-8(13)11-6-4-7-3-1-2-5-10-7/h1-3,5H,4,6,9H2,(H2,11,12,13)

InChI key: InChIKey=UHPMTSNQAFFPSP-UHFFFAOYSA-N

SMILES: C(CNC(NN)=S)C1=CC=CC=N1

Synonyms:

• Hydrazinecarbothioamide, N-[2-(2-pyridinyl)ethyl]-
• 3-Amino-1-[2-(pyridin-2-yl)ethyl]thiourea
• N-[2-(2-Pyridinyl)ethyl]hydrazinecarbothioamide

3-Amino-1-[2-(pyridin-2-yl)ethyl]thiourea

CAS: 76609-48-8

Versatile small molecule scaffold

Formula: C₈H₁₂N₄S

Purity: Min. 95%

Molecular weight: 196.28 g/mol

Ref: 3D-BDA60948