CAS 7661-30-5
:1-(2-Bromophenyl)-2-pyrrolidinone
Description:
1-(2-Bromophenyl)-2-pyrrolidinone, with the CAS number 7661-30-5, is an organic compound characterized by its unique structure, which includes a pyrrolidinone ring and a bromophenyl substituent. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the bromine atom in the aromatic ring can influence its reactivity and biological activity, making it a subject of interest in synthetic organic chemistry. Additionally, the compound may exhibit specific physical properties such as melting and boiling points, which are influenced by its molecular structure. Safety and handling precautions are essential when working with this compound, as it may pose health risks if not managed properly. Overall, 1-(2-Bromophenyl)-2-pyrrolidinone is a significant compound in research and development within the field of chemistry.
Formula:C10H10BrNO
InChI:InChI=1/C10H10BrNO/c11-8-4-1-2-5-9(8)12-7-3-6-10(12)13/h1-2,4-5H,3,6-7H2
InChI key:InChIKey=FXXUXPJETBQBKX-UHFFFAOYSA-N
SMILES:O=C1N(CCC1)C2=C(Br)C=CC=C2
Synonyms:- 1-(2-Bromophenyl)-2-pyrrolidinone
- 2-Pyrrolidinone, 1-(2-bromophenyl)-
- 2-Pyrrolidinone, 1-(o-bromophenyl)-
- 1-(2-Bromophenyl)pyrrolidin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
