CAS 76621-12-0
:1,3,8-trichlorodibenzo[b,d]furan
Description:
1,3,8-Trichlorodibenzo[b,d]furan is a synthetic organic compound characterized by its complex polycyclic structure, which consists of two fused benzene rings and a furan ring, with three chlorine substituents at the 1, 3, and 8 positions. This compound is part of a larger class of chlorinated dibenzofurans, which are known for their environmental persistence and potential toxicity. It typically appears as a solid at room temperature and is poorly soluble in water, but may dissolve in organic solvents. The presence of chlorine atoms enhances its stability and lipophilicity, contributing to its bioaccumulation potential in living organisms. 1,3,8-Trichlorodibenzo[b,d]furan is of interest in environmental chemistry due to its formation as a byproduct in various industrial processes, particularly in the production of chlorinated compounds. Its toxicological profile suggests that it may exhibit harmful effects on aquatic life and potentially pose risks to human health, necessitating careful handling and regulation.
Formula:C12H5Cl3O
InChI:InChI=1/C12H5Cl3O/c13-6-1-2-10-8(3-6)12-9(15)4-7(14)5-11(12)16-10/h1-5H
SMILES:c1cc2c(cc1Cl)c1c(cc(cc1o2)Cl)Cl
Synonyms:- 1,3,8-Trichlorodibenzofuran
- Dibenzofuran, 1,3,8-trichloro
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.