
CAS 76622-27-0
:2-(3,4-Dimethoxyphenyl)-6,7-dimethoxy-4H-1-benzopyran-4-one
Description:
2-(3,4-Dimethoxyphenyl)-6,7-dimethoxy-4H-1-benzopyran-4-one, with the CAS number 76622-27-0, is a synthetic organic compound belonging to the class of flavonoids, specifically a flavone. This compound features a benzopyran core structure, which is characterized by a fused benzene and pyran ring. The presence of multiple methoxy groups (–OCH3) at the 3, 4, 6, and 7 positions contributes to its unique chemical properties, enhancing its solubility and potentially influencing its biological activity. The compound is known for its potential antioxidant and anti-inflammatory properties, making it of interest in pharmacological research. Its molecular structure allows for various interactions with biological targets, which may lead to therapeutic applications. Additionally, the compound may exhibit UV-absorbing properties due to its conjugated system, making it relevant in studies related to photoprotection. Overall, 2-(3,4-Dimethoxyphenyl)-6,7-dimethoxy-4H-1-benzopyran-4-one represents a fascinating subject for further investigation in medicinal chemistry and natural product synthesis.
Formula:C19H18O6
InChI:InChI=1S/C19H18O6/c1-21-14-6-5-11(7-17(14)22-2)15-9-13(20)12-8-18(23-3)19(24-4)10-16(12)25-15/h5-10H,1-4H3
InChI key:InChIKey=NVTJLSRVWFAVPB-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC(OC)=C(OC)C=C3)=CC(OC)=C(OC)C2
Synonyms:- 2-(3,4-Dimethoxyphenyl)-6,7-dimethoxychromen-4-one
- 6,7,3′,4′-Tetramethoxyflavone
- NSC 241354
- 4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-6,7-dimethoxy-
- 2-(3,4-Dimethoxyphenyl)-6,7-dimethoxy-4H-1-benzopyran-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.