CAS 76629-21-5

Imidazo[2,1-b]thiazole-3-acetic acid, 5,6-dihydro-, hydrochloride (1:1)

Description:

Imidazo[2,1-b]thiazole-3-acetic acid, 5,6-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and thiazole rings. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. The presence of the acetic acid moiety suggests it may exhibit acidic properties, while the hydrochloride form indicates it is a salt, enhancing its solubility in aqueous environments. This compound is often studied for its pharmacological potential, particularly in medicinal chemistry, where modifications to its structure can lead to derivatives with improved efficacy or reduced toxicity. Its CAS number, 76629-21-5, allows for precise identification in chemical databases. As with many heterocycles, it may display a range of reactivity patterns, making it of interest in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential health hazards associated with exposure.

Formula: C₇H₈N₂O₂S·ClH

InChI: InChI=1S/C7H8N2O2S.ClH/c10-6(11)3-5-4-12-7-8-1-2-9(5)7;/h4H,1-3H2,(H,10,11);1H

InChI key: InChIKey=KDPMVWCZJGAAIO-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1N2C(SC1)=NCC2.Cl

Synonyms:

• Imidazo[2,1-b]thiazole-3-acetic acid, 5,6-dihydro-, monohydrochloride
• Imidazo[2,1-b]thiazole-3-acetic acid, 5,6-dihydro-, hydrochloride (1:1)
• 2-(5,6-Dihydroimidazo[2,1-b]thiazol-3-yl)acetic acid hydrochloride

3-(Carboxymethyl)-5,6-dihydroimidazo[2,1-B][1,3]thiazol-4-ium Chloride

CAS: 76629-21-5

Versatile small molecule scaffold

Formula: C₇H₈N₂O₂S·HCl

Purity: Min. 95%

Molecular weight: 220.67 g/mol

Ref: 3D-BDA62921