CAS 76629-22-6

5H-Thiazolo[3,2-a]pyrimidine-3-acetic acid, 6,7-dihydro-, ethyl ester, hydrochloride (1:1)

Description:

5H-Thiazolo[3,2-a]pyrimidine-3-acetic acid, 6,7-dihydro-, ethyl ester, hydrochloride (1:1), with CAS number 76629-22-6, is a chemical compound that features a thiazolo-pyrimidine core structure, which is characterized by a fused thiazole and pyrimidine ring system. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural motifs. The presence of the ethyl ester group suggests it may have solubility in organic solvents and could participate in various chemical reactions, such as hydrolysis. The hydrochloride form indicates that it is a salt, which often enhances the stability and solubility of the compound in aqueous solutions. Such compounds are of interest in medicinal chemistry for their potential pharmacological properties, including antimicrobial or anti-inflammatory activities. However, specific biological activities and applications would require further investigation through empirical studies. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₀H₁₄N₂O₂S·ClH

InChI: InChI=1S/C10H14N2O2S.ClH/c1-2-14-9(13)6-8-7-15-10-11-4-3-5-12(8)10;/h7H,2-6H2,1H3;1H

InChI key: InChIKey=UFBKMCIESOARGC-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C=1N2C(SC1)=NCCC2.Cl

Synonyms:

• 5H-Thiazolo[3,2-a]pyrimidine-3-acetic acid, 6,7-dihydro-, ethyl ester, hydrochloride (1:1)
• 5H-Thiazolo[3,2-a]pyrimidine-3-acetic acid, 6,7-dihydro-, ethyl ester, monohydrochloride