CAS 76642-19-8
:Benzenamine, 4-methyl-, homopolymer
Description:
Benzenamine, 4-methyl-, homopolymer, also known as p-toluidine homopolymer, is a synthetic polymer derived from the polymerization of p-toluidine, an aromatic amine. This substance typically exhibits characteristics common to aromatic polymers, including good thermal stability and resistance to chemical degradation. It is generally insoluble in water but may dissolve in organic solvents, depending on its molecular weight and structure. The polymer's mechanical properties can vary widely, influenced by factors such as molecular weight and degree of cross-linking. It may possess moderate to high tensile strength and flexibility, making it suitable for various applications, including coatings, adhesives, and as a component in composite materials. Additionally, due to the presence of amine groups, the polymer can participate in further chemical reactions, allowing for functionalization or modification. Safety considerations are important, as p-toluidine and its derivatives can be toxic and potentially carcinogenic, necessitating proper handling and disposal measures in industrial and laboratory settings.
Formula:(C7H9N)x
InChI:InChI=1S/C7H9N/c1-6-2-4-7(8)5-3-6/h2-5H,8H2,1H3
InChI key:InChIKey=RZXMPPFPUUCRFN-UHFFFAOYSA-N
SMILES:CC1=CC=C(N)C=C1
Synonyms:- p-Toluidine polymer
- Poly-para-toluidine
- Poly(4-methylaniline)
- Poly(p-methylaniline)
- Benzenamine, 4-methyl-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
