CAS 76644-41-2

1-{[(E)-(4-hydroxy-5-nitrofuran-2-yl)methylidene]amino}imidazolidine-2,4-dione

Description:

1-{[(E)-(4-hydroxy-5-nitrofuran-2-yl)methylidene]amino}imidazolidine-2,4-dione, with CAS number 76644-41-2, is a chemical compound characterized by its complex structure that includes an imidazolidine ring and a furan moiety. This compound features a nitro group and a hydroxyl group, which contribute to its potential biological activity and reactivity. The presence of the imidazolidine-2,4-dione framework suggests that it may exhibit properties typical of diketones, such as the ability to participate in various chemical reactions, including nucleophilic additions and cyclization. The furan ring, known for its aromaticity, may also influence the compound's stability and reactivity. This substance may be of interest in medicinal chemistry due to its potential pharmacological properties, particularly in the development of new therapeutic agents. Its unique functional groups could facilitate interactions with biological targets, making it a candidate for further research in drug discovery and development. However, specific applications and biological effects would require detailed experimental studies to elucidate its full potential.

Formula: C₈H₆N₄O₆

InChI: InChI=1/C8H6N4O6/c13-5-1-4(18-7(5)12(16)17)2-9-11-3-6(14)10-8(11)15/h1-2,13H,3H2,(H,10,14,15)/b9-2+