CymitQuimica logo

CAS 76644-75-2

:

1H-Isoindol-3-amine, 6-chloro-, hydrochloride (1:1)

Description:
1H-Isoindol-3-amine, 6-chloro-, hydrochloride (1:1) is a chemical compound characterized by its isoindole structure, which features a bicyclic system comprising a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 6-position of the isoindole ring contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and facilitates its handling in laboratory settings. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its amine functional group that can participate in various chemical reactions, including hydrogen bonding and nucleophilic substitution. Its specific applications and biological activities would depend on further research, but compounds of this class are often investigated for their roles in neuropharmacology and other therapeutic areas. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C8H7ClN2·ClH
InChI:InChI=1S/C8H7ClN2.ClH/c9-6-1-2-7-5(3-6)4-11-8(7)10;/h1-3H,4H2,(H2,10,11);1H
InChI key:InChIKey=WHFDJXQCKGWRLF-UHFFFAOYSA-N
SMILES:NC=1C=2C(CN1)=CC(Cl)=CC2.Cl
Synonyms:
  • 1H-Isoindol-3-amine, 6-chloro-, monohydrochloride
  • 1H-Isoindol-3-amine, 6-chloro-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.