CAS 76647-70-6
:5-Deoxy-L-arabinonic acid γ-lactone
Description:
5-Deoxy-L-arabinonic acid γ-lactone is a chemical compound characterized by its lactone structure, which is a cyclic ester formed from the condensation of a hydroxy acid. This compound is derived from L-arabinonic acid, a sugar acid, and features a five-membered ring that includes an ester functional group. It is typically a white to off-white solid and is soluble in water due to the presence of hydroxyl groups. The compound is of interest in biochemical research, particularly in studies related to carbohydrate metabolism and enzymatic reactions. Its molecular structure allows it to participate in various chemical reactions, making it a useful intermediate in organic synthesis. Additionally, the lactone form can exhibit different reactivity compared to its open-chain counterpart, influencing its behavior in biological systems. As with many organic compounds, proper handling and storage are essential to maintain its stability and prevent degradation.
Formula:C5H8O4
InChI:InChI=1S/C5H8O4/c1-2-3(6)4(7)5(8)9-2/h2-4,6-7H,1H3/t2-,3-,4+/m0/s1
InChI key:InChIKey=JYHWQRJRDKSSIF-YVZJFKFKSA-N
SMILES:O[C@@H]1[C@@H](O)C(=O)O[C@H]1C
Synonyms:- 5-Deoxy-<span class="text-smallcaps">L</span>-arabinonic acid γ-lactone
- 5-Deoxy-L-arabino-1,4-lactone
- <span class="text-smallcaps">L</span>-Arabinonic acid, 5-deoxy-, γ-lactone
- L-5-Deoxy-Arabinono-1,4-Lactone
- 5-Deoxy-L-arabinonic acid γ-lactone
- L-Arabinonic acid, 5-deoxy-, γ-lactone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Deoxy-L-arabonic acid 1,4-lactone
CAS:<p>5-Deoxy-L-arabonic acid 1,4-lactone is a phytochemical present in the flowers of some plants. It has been shown to have anti-cancer properties in lung cancer cells by inhibiting the growth of these cells. 5-Deoxy-L-arabonic acid 1,4-lactone inhibits cell division and induces apoptosis by binding to DNA, preventing replication. This compound also inhibits the production of prostaglandins that promote inflammation, which may be related to its anti-cancer effects. 5-Deoxy-L-arabonic acid 1,4-lactone has been shown to inhibit the production of phenolic compounds such as vanillic acid and apigenin in lung cancer cell lines. These compounds have been shown to have chemopreventive activities against various cancers including breast cancer and colon cancer.</p>Formula:C5H8O4Purity:Min. 95%Color and Shape:PowderMolecular weight:132.12 g/mol

