CymitQuimica logo

CAS 766475-74-5

:

(1-diazo-2-oxo-propyl)-methoxy-phosphinic acid

Description:
(1-diazo-2-oxo-propyl)-methoxy-phosphinic acid, identified by its CAS number 766475-74-5, is a chemical compound that features a unique structure characterized by the presence of a diazo group, a ketone, and a phosphinic acid moiety. This compound is likely to exhibit properties typical of phosphinic acids, such as being a weak acid due to the presence of the phosphinic functional group. The diazo group may impart reactivity, making it useful in various synthetic applications, including organic synthesis and potential use in pharmaceuticals. The methoxy group contributes to the compound's solubility and reactivity, influencing its behavior in chemical reactions. Overall, the combination of these functional groups suggests that this compound could participate in a range of chemical transformations, making it of interest in both academic research and industrial applications. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications.
Formula:C4H8N2O4P
InChI:InChI=1/C4H7N2O4P/c1-3(7)4(6-5)11(8,9)10-2/h1-2H3,(H,8,9)
SMILES:CC(=O)C(=[P-](=O)(O)OC)[N+]#N
Synonyms:
  • Methyl Hydrogen (1-Diazo-2-Oxopropyl)Phosphonate
  • Methyl-hydrogen-(1-diazo-2-oxopropyl)phosphonat
  • phosphonic acid, P-(1-diazo-2-oxopropyl)-, monomethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.