CAS 76649-14-4
:3-Octen-2-ol
Description:
3-Octen-2-ol is an organic compound classified as an unsaturated alcohol, characterized by its long carbon chain and the presence of both a hydroxyl (-OH) group and a double bond within its structure. It features a total of eight carbon atoms, with the double bond located between the third and fourth carbon atoms, and the hydroxyl group attached to the second carbon. This compound is typically a colorless to pale yellow liquid with a distinctive odor, often described as floral or fruity. It is soluble in organic solvents and exhibits moderate solubility in water due to the presence of the hydroxyl group. 3-Octen-2-ol is used in various applications, including as a flavoring agent and in the synthesis of other chemical compounds. Its reactivity is influenced by the double bond, making it susceptible to reactions such as oxidation and polymerization. Additionally, it may have potential applications in the fragrance industry due to its pleasant aroma. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H16O
InChI:InChI=1S/C8H16O/c1-3-4-5-6-7-8(2)9/h6-9H,3-5H2,1-2H3
InChI key:InChIKey=YJJIVDCKSZMHGZ-UHFFFAOYSA-N
SMILES:C(=CC(C)O)CCCC
Synonyms:- 3-Octen-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
