CymitQuimica logo

CAS 76650-20-9

:

(2E)-3-(3,4-dimethoxyphenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one

Description:
The chemical substance known as (2E)-3-(3,4-dimethoxyphenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one, with the CAS number 76650-20-9, is an organic compound characterized by its complex structure featuring multiple methoxy groups attached to phenyl rings. This compound belongs to the class of chalcones, which are known for their conjugated double bond system that contributes to their reactivity and potential biological activity. The presence of methoxy groups enhances its solubility and may influence its electronic properties, making it a subject of interest in various fields, including medicinal chemistry and materials science. Chalcones are often studied for their anti-inflammatory, antioxidant, and anticancer properties, and this particular compound may exhibit similar biological activities due to its structural features. Additionally, its stability and reactivity can be influenced by the arrangement of substituents on the aromatic rings, which can affect its interaction with biological targets. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C20H22O6
InChI:InChI=1/C20H22O6/c1-22-14-11-18(25-4)20(19(12-14)26-5)15(21)8-6-13-7-9-16(23-2)17(10-13)24-3/h6-12H,1-5H3/b8-6+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.