CymitQuimica logo

CAS 766508-67-2

:

3-(4-piperidyl)benzoic acid

Description:
3-(4-Piperidyl)benzoic acid, identified by its CAS number 766508-67-2, is an organic compound characterized by a benzoic acid structure substituted with a piperidine ring at the meta position. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents like water and higher solubility in organic solvents. The presence of both the carboxylic acid group and the piperidine moiety contributes to its potential as a ligand in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The piperidine ring can enhance the compound's ability to interact with biological receptors, while the benzoic acid portion may influence its pharmacokinetic properties. Additionally, 3-(4-piperidyl)benzoic acid may exhibit acidic behavior due to the carboxylic acid group, allowing it to participate in various chemical reactions, including esterification and amidation. Overall, this compound's unique structure and functional groups make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C12H15NO2
InChI:InChI=1/C12H15NO2/c14-12(15)11-3-1-2-10(8-11)9-4-6-13-7-5-9/h1-3,8-9,13H,4-7H2,(H,14,15)
InChI key:ICCKWGCLHGIEQE-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)C(=O)O)C1CCNCC1
Synonyms:
  • 3-(Piperidin-4-Yl)Benzoic Acid
  • Benzoic acid, 3-(4-piperidinyl)-
  • 4-(3-Carboxyphenyl)piperidine
Found 4 products.