CAS 766508-72-9
:4-Amino-2-bromocyclohexanone
Description:
4-Amino-2-bromocyclohexanone is an organic compound characterized by its cyclohexanone structure, which features a bromine atom and an amino group attached to the cyclohexane ring. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The bromine atom introduces a halogen functionality, which can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The amino group contributes to its basicity and can participate in further chemical transformations, such as acylation or alkylation. This compound may be of interest in medicinal chemistry and synthetic organic chemistry due to its potential applications in drug development or as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Amino-2-bromocyclohexanone is a versatile compound with notable chemical properties.
Formula:C6H10BrNO
InChI:InChI=1S/C6H10BrNO/c7-5-3-4(8)1-2-6(5)9/h4-5H,1-3,8H2
InChI key:InChIKey=GHFBIKLFXROSAE-UHFFFAOYSA-N
SMILES:BrC1C(=O)CCC(N)C1
Synonyms:- 4-Amino-2-bromocyclohexanone
- Cyclohexanone, 4-amino-2-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
