CAS 766520-01-8

5-(3,5-Dibromophenyl)-1H-pyrazol-3-amine

Description:

5-(3,5-Dibromophenyl)-1H-pyrazol-3-amine is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 3,5-dibromophenyl group indicates that the compound has two bromine substituents on the phenyl ring, contributing to its unique chemical properties and potential reactivity. This compound is typically used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. Its structure suggests that it may exhibit properties such as enhanced lipophilicity and specific interactions with biological targets. The compound's molecular weight, solubility, and stability can vary based on environmental conditions and the presence of other functional groups. Additionally, the bromine atoms can influence the compound's electronic properties, making it a subject of interest in studies related to drug design and synthesis. Safety and handling precautions should be observed due to the presence of halogens, which can pose environmental and health risks.

Formula: C₉H₇Br₂N₃

InChI: InChI=1S/C9H7Br2N3/c10-6-1-5(2-7(11)3-6)8-4-9(12)14-13-8/h1-4H,(H3,12,13,14)

InChI key: InChIKey=OCVRBHKXKBZUDS-UHFFFAOYSA-N

SMILES: BrC=1C=C(C=C(Br)C1)C=2NN=C(N)C2

Synonyms:

• 1H-Pyrazol-3-amine, 5-(3,5-dibromophenyl)-
• 5-(3,5-Dibromophenyl)-1H-pyrazol-3-amine