CAS 766533-80-6

N-(4-amino-2-methylphenyl)-2-methylpropanamide

Description:

N-(4-amino-2-methylphenyl)-2-methylpropanamide, also known by its CAS number 766533-80-6, is an organic compound characterized by its amide functional group, which is derived from the reaction of an amine and a carboxylic acid. This substance features a 2-methylpropanamide backbone, indicating the presence of a branched alkyl chain, and a 4-amino-2-methylphenyl group, which contributes to its aromatic character and potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds like this may exhibit properties such as moderate to high solubility in polar solvents, depending on the specific functional groups and their interactions. Additionally, the structural features may impart specific pharmacological properties, making it of interest in medicinal chemistry. Overall, the characteristics of this compound can be explored further through its physical properties, reactivity, and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₁H₁₆N₂O

InChI: InChI=1/C11H16N2O/c1-7(2)11(14)13-10-5-4-9(12)6-8(10)3/h4-7H,12H2,1-3H3,(H,13,14)

SMILES: CC(C)C(=O)Nc1ccc(cc1C)N

Synonyms:

• UKRORGSYN-BB BBV-011370
• N-(4-amino-2-methylphenyl)-2-methylpropanamide
• N-(4-amino-2-methylphenyl)-2-methylpropanamide(SALTDATA: FREE)
• AKOS BBV-011370
• Propanamide, N-(4-amino-2-methylphenyl)-2-methyl-