CAS 766539-34-8
:Methyl 4-(phenylmethyl)-2-morpholineacetate
Description:
Methyl 4-(phenylmethyl)-2-morpholineacetate, identified by its CAS number 766539-34-8, is an organic compound characterized by its morpholine and ester functional groups. This compound features a morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom, contributing to its potential biological activity. The presence of the phenylmethyl group enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. As an ester, it may undergo hydrolysis in the presence of water, leading to the release of the corresponding acid and alcohol. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in drug design, due to the morpholine moiety's role in enhancing pharmacokinetic properties. Additionally, its unique combination of functional groups may impart specific reactivity and stability characteristics, making it of interest in synthetic organic chemistry. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its properties and potential uses.
Formula:C14H19NO3
InChI:InChI=1S/C14H19NO3/c1-17-14(16)9-13-11-15(7-8-18-13)10-12-5-3-2-4-6-12/h2-6,13H,7-11H2,1H3
InChI key:InChIKey=HPLLEDNQVOZKFU-UHFFFAOYSA-N
SMILES:C(N1CC(CC(OC)=O)OCC1)C2=CC=CC=C2
Synonyms:- 2-Morpholineacetic acid, 4-(phenylmethyl)-, methyl ester
- Methyl 2-(4-benzylmorpholin-2-yl)acetate
- (4-Benzyl-morpholin-2-yl)-acetic acid methyl ester
- Methyl 4-(phenylmethyl)-2-morpholineacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
