CAS 766539-77-9
:ethyl 3-tetrahydrofuran-3-ylpropanoate
Description:
Ethyl 3-tetrahydrofuran-3-ylpropanoate is an organic compound characterized by its ester functional group, which is formed from the reaction of an alcohol and a carboxylic acid. This compound features a tetrahydrofuran ring, contributing to its cyclic structure and potentially influencing its reactivity and solubility. The presence of the ethyl group indicates that it is a relatively low molecular weight compound, which may enhance its volatility and potential applications in various fields, such as flavoring, fragrance, or as a solvent. The propanoate moiety suggests that it may exhibit moderate polarity, affecting its interactions with other substances. Additionally, the compound's structure may impart specific physical properties, such as boiling and melting points, which are essential for its practical applications. Overall, ethyl 3-tetrahydrofuran-3-ylpropanoate is a versatile compound with unique characteristics that can be utilized in synthetic chemistry and industrial applications.
Formula:C9H16O3
InChI:InChI=1/C9H16O3/c1-2-12-9(10)4-3-8-5-6-11-7-8/h8H,2-7H2,1H3
SMILES:CCOC(=O)CCC1CCOC1
Synonyms:- 3-(Tetrahydro-furan-3-yl)-propionic acid ethyl ester
- 3-Furanpropanoic Acid, Tetrahydro-, Ethyl Ester
- Ethyl 3-(tetrahydrofuran-3-yl)propanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.